C31H31N3O3 — CID 143918006
1,3-bis[(E)-3-phenylprop-2-enyl]-5-[(2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 143918006) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is 1,3-bis[(E)-3-phenylprop-2-enyl]-5-[(2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis[(E)-3-phenylprop-2-enyl]-5-[(2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 143918006 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 1,3-bis[(E)-3-phenylprop-2-enyl]-5-[(2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=C/C=C(\C=C/C)/C=C/Cn1c(=O)n(C/C=C/c2ccccc2)c(=O)n(C/C=C/c2ccccc2)c1=O |
| InChI | InChI=1S/C31H31N3O3/c1-3-14-26(15-4-2)20-11-23-32-29(35)33(24-12-21-27-16-7-5-8-17-27)31(37)34(30(32)36)25-13-22-28-18-9-6-10-19-28/h3-22H,1,23-25H2,2H3/b15-4-,20-11+,21-12+,22-13+,26-14+ |
| InChIKey | BARFZPKKFDPCOU-JXKIBZHZSA-N |
| XLogP | 4.84 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|