C11H13NO — CID 143918727
(2S)-4-cyclohepta-1,3,6-trien-1-yl-2-hydroxybutanenitrile (PubChem CID 143918727) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is (2S)-4-cyclohepta-1,3,6-trien-1-yl-2-hydroxybutanenitrile.
| Compound Name | (2S)-4-cyclohepta-1,3,6-trien-1-yl-2-hydroxybutanenitrile |
|---|---|
| PubChem CID | 143918727 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (2S)-4-cyclohepta-1,3,6-trien-1-yl-2-hydroxybutanenitrile |
| SMILES | N#C[C@@H](O)CCC1=CC=CCC=C1 |
| InChI | InChI=1S/C11H13NO/c12-9-11(13)8-7-10-5-3-1-2-4-6-10/h1,3-6,11,13H,2,7-8H2/t11-/m0/s1 |
| InChIKey | RTDCUHDPYPBATN-NSHDSACASA-N |
| XLogP | 2.09 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|