C24H24N4O — CID 143919542
2-[6-[[(3R)-3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]indol-1-yl]acetaldehyde (PubChem CID 143919542) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[6-[[(3R)-3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]indol-1-yl]acetaldehyde.
| Compound Name | 2-[6-[[(3R)-3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]indol-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 143919542 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-[6-[[(3R)-3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]indol-1-yl]acetaldehyde |
| SMILES | O=CCn1ccc2ccc(CN3CC[C@@H](Nc4cccc5cnccc45)C3)cc21 |
| InChI | InChI=1S/C24H24N4O/c29-13-12-28-11-7-19-5-4-18(14-24(19)28)16-27-10-8-21(17-27)26-23-3-1-2-20-15-25-9-6-22(20)23/h1-7,9,11,13-15,21,26H,8,10,12,16-17H2/t21-/m1/s1 |
| InChIKey | HXZKAYYCXBNAJR-OAQYLSRUSA-N |
| XLogP | 4.07 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|