C25H29N5O — CID 143919541
2-[6-[[(3R)-3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]indol-1-yl]acetaldehyde;methanamine (PubChem CID 143919541) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-[6-[[(3R)-3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]indol-1-yl]acetaldehyde;methanamine.
| Compound Name | 2-[6-[[(3R)-3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]indol-1-yl]acetaldehyde;methanamine |
|---|---|
| PubChem CID | 143919541 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 2-[6-[[(3R)-3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]indol-1-yl]acetaldehyde;methanamine |
| SMILES | CN.O=CCn1ccc2ccc(CN3CC[C@@H](Nc4cccc5cnccc45)C3)cc21 |
| InChI | InChI=1S/C24H24N4O.CH5N/c29-13-12-28-11-7-19-5-4-18(14-24(19)28)16-27-10-8-21(17-27)26-23-3-1-2-20-15-25-9-6-22(20)23;1-2/h1-7,9,11,13-15,21,26H,8,10,12,16-17H2;2H2,1H3/t21-;/m1./s1 |
| InChIKey | JGXNOVIAOSQEKY-ZMBIFBSDSA-N |
| XLogP | 3.65 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|