C22H26N4O2S — CID 68816511
1-[3-[[3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]phenyl]ethanesulfonamide (PubChem CID 68816511) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-[3-[[3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]phenyl]ethanesulfonamide.
| Compound Name | 1-[3-[[3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 68816511 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-[3-[[3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]phenyl]ethanesulfonamide |
| SMILES | CC(c1cccc(CN2CCC(Nc3cccc4cnccc34)C2)c1)S(N)(=O)=O |
| InChI | InChI=1S/C22H26N4O2S/c1-16(29(23,27)28)18-5-2-4-17(12-18)14-26-11-9-20(15-26)25-22-7-3-6-19-13-24-10-8-21(19)22/h2-8,10,12-13,16,20,25H,9,11,14-15H2,1H3,(H2,23,27,28) |
| InChIKey | BLPFEECBOOFOLC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |