About 3,5-dimethyl-2-(2-methylbutyl)cyclohepta-1,3,5-triene
3,5-dimethyl-2-(2-methylbutyl)cyclohepta-1,3,5-triene (PubChem CID 143923068) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is 3,5-dimethyl-2-(2-methylbutyl)cyclohepta-1,3,5-triene.
Analyze 3,5-dimethyl-2-(2-methylbutyl)cyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-2-(2-methylbutyl)cyclohepta-1,3,5-triene?
The IUPAC name of 3,5-dimethyl-2-(2-methylbutyl)cyclohepta-1,3,5-triene (CID 143923068) is 3,5-dimethyl-2-(2-methylbutyl)cyclohepta-1,3,5-triene.
What is the SMILES notation for 3,5-dimethyl-2-(2-methylbutyl)cyclohepta-1,3,5-triene?
The canonical SMILES for 3,5-dimethyl-2-(2-methylbutyl)cyclohepta-1,3,5-triene is CCC(C)CC1=CCC=C(C)C=C1C.
What is the InChIKey of 3,5-dimethyl-2-(2-methylbutyl)cyclohepta-1,3,5-triene?
The InChIKey is LNTLXTRTTFSOBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22/c1-5-11(2)10-14-8-6-7-12(3)9-13(14)4/h7-9,11H,5-6,10H2,1-4H3.
What are the key properties of 3,5-dimethyl-2-(2-methylbutyl)cyclohepta-1,3,5-triene?
3,5-dimethyl-2-(2-methylbutyl)cyclohepta-1,3,5-triene has a molecular weight of 190.33 g/mol, XLogP of 4.65, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2-(2-methylbutyl)cyclohepta-1,3,5-triene is sourced from PubChem (CID 143923068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).