C14H24S — CID 89228152
3-methyl-4-[(4S)-4-methylhexyl]cyclohexa-2,4-diene-1-thiol (PubChem CID 89228152) has the molecular formula C14H24S and a molecular weight of 224.41 g/mol. Its IUPAC name is 3-methyl-4-[(4S)-4-methylhexyl]cyclohexa-2,4-diene-1-thiol.
| Compound Name | 3-methyl-4-[(4S)-4-methylhexyl]cyclohexa-2,4-diene-1-thiol |
|---|---|
| PubChem CID | 89228152 |
| Molecular Formula | C14H24S |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 3-methyl-4-[(4S)-4-methylhexyl]cyclohexa-2,4-diene-1-thiol |
| SMILES | CC[C@H](C)CCCC1=CCC(S)C=C1C |
| InChI | InChI=1S/C14H24S/c1-4-11(2)6-5-7-13-8-9-14(15)10-12(13)3/h8,10-11,14-15H,4-7,9H2,1-3H3/t11-,14?/m0/s1 |
| InChIKey | BAOFOBMPDMCUBQ-ZSOXZCCMSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|