C20H27N3O3 — CID 143923908
2-amino-N-(2-amino-2-oxoethyl)-3-(4-methoxyphenyl)propanamide;1,2-xylene (PubChem CID 143923908) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-amino-N-(2-amino-2-oxoethyl)-3-(4-methoxyphenyl)propanamide;1,2-xylene.
| Compound Name | 2-amino-N-(2-amino-2-oxoethyl)-3-(4-methoxyphenyl)propanamide;1,2-xylene |
|---|---|
| PubChem CID | 143923908 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 2-amino-N-(2-amino-2-oxoethyl)-3-(4-methoxyphenyl)propanamide;1,2-xylene |
| SMILES | COc1ccc(CC(N)C(=O)NCC(N)=O)cc1.Cc1ccccc1C |
| InChI | InChI=1S/C12H17N3O3.C8H10/c1-18-9-4-2-8(3-5-9)6-10(13)12(17)15-7-11(14)16;1-7-5-3-4-6-8(7)2/h2-5,10H,6-7,13H2,1H3,(H2,14,16)(H,15,17);3-6H,1-2H3 |
| InChIKey | JFWZSMUSMWPMTP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |