C20H25FN2O2 — CID 143923918
4-[4-(dimethylamino)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile;fluorobenzene (PubChem CID 143923918) has the molecular formula C20H25FN2O2 and a molecular weight of 344.43 g/mol. Its IUPAC name is 4-[4-(dimethylamino)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile;fluorobenzene.
| Compound Name | 4-[4-(dimethylamino)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile;fluorobenzene |
|---|---|
| PubChem CID | 143923918 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 4-[4-(dimethylamino)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile;fluorobenzene |
| SMILES | CN(C)CCCC(O)c1ccc(C#N)cc1CO.Fc1ccccc1 |
| InChI | InChI=1S/C14H20N2O2.C6H5F/c1-16(2)7-3-4-14(18)13-6-5-11(9-15)8-12(13)10-17;7-6-4-2-1-3-5-6/h5-6,8,14,17-18H,3-4,7,10H2,1-2H3;1-5H |
| InChIKey | KHSRPNVLNBWUKW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |