C20H25FN2O6S — CID 170329123
4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile;sulfuric acid (PubChem CID 170329123) has the molecular formula C20H25FN2O6S and a molecular weight of 440.49 g/mol. Its IUPAC name is 4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile;sulfuric acid.
| Compound Name | 4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile;sulfuric acid |
|---|---|
| PubChem CID | 170329123 |
| Molecular Formula | C20H25FN2O6S |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile;sulfuric acid |
| SMILES | CN(C)CCCC(O)(c1ccc(F)cc1)c1ccc(C#N)cc1CO.O=S(=O)(O)O |
| InChI | InChI=1S/C20H23FN2O2.H2O4S/c1-23(2)11-3-10-20(25,17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24;1-5(2,3)4/h4-9,12,24-25H,3,10-11,14H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | PCRXVACPRVYTQU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 142.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|