C20H25FIN3O3 — CID 142841206
[(Z)-[amino-[4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)phenyl]methylidene]amino] hypoiodite (PubChem CID 142841206) has the molecular formula C20H25FIN3O3 and a molecular weight of 501.34 g/mol. Its IUPAC name is [(Z)-[amino-[4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)phenyl]methylidene]amino] hypoiodite.
| Compound Name | [(Z)-[amino-[4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)phenyl]methylidene]amino] hypoiodite |
|---|---|
| PubChem CID | 142841206 |
| Molecular Formula | C20H25FIN3O3 |
| Molecular Weight | 501.34 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | [(Z)-[amino-[4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)phenyl]methylidene]amino] hypoiodite |
| SMILES | CN(C)CCCC(O)(c1ccc(F)cc1)c1ccc(/C(N)=N/OI)cc1CO |
| InChI | InChI=1S/C20H25FIN3O3/c1-25(2)11-3-10-20(27,16-5-7-17(21)8-6-16)18-9-4-14(12-15(18)13-26)19(23)24-28-22/h4-9,12,26-27H,3,10-11,13H2,1-2H3,(H2,23,24) |
| InChIKey | JFNFYIIYPZVFEH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|