C26H36FNO4 — CID 175256723
[4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(5-hydroxypentyl)phenyl]methyl acetate (PubChem CID 175256723) has the molecular formula C26H36FNO4 and a molecular weight of 445.58 g/mol. Its IUPAC name is [4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(5-hydroxypentyl)phenyl]methyl acetate.
| Compound Name | [4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(5-hydroxypentyl)phenyl]methyl acetate |
|---|---|
| PubChem CID | 175256723 |
| Molecular Formula | C26H36FNO4 |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | [4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(5-hydroxypentyl)phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(C(O)(CCCN(C)C)c2ccc(F)cc2)c(CCCCCO)c1 |
| InChI | InChI=1S/C26H36FNO4/c1-20(30)32-19-21-9-14-25(22(18-21)8-5-4-6-17-29)26(31,15-7-16-28(2)3)23-10-12-24(27)13-11-23/h9-14,18,29,31H,4-8,15-17,19H2,1-3H3 |
| InChIKey | RRLJFYLTDPQBPB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|