C21H28FNO — CID 59994702
4-(dimethylamino)-1-(2-ethyl-4-methylphenyl)-1-(4-fluorophenyl)butan-1-ol (PubChem CID 59994702) has the molecular formula C21H28FNO and a molecular weight of 329.46 g/mol. Its IUPAC name is 4-(dimethylamino)-1-(2-ethyl-4-methylphenyl)-1-(4-fluorophenyl)butan-1-ol.
| Compound Name | 4-(dimethylamino)-1-(2-ethyl-4-methylphenyl)-1-(4-fluorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 59994702 |
| Molecular Formula | C21H28FNO |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 4-(dimethylamino)-1-(2-ethyl-4-methylphenyl)-1-(4-fluorophenyl)butan-1-ol |
| SMILES | CCc1cc(C)ccc1C(O)(CCCN(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H28FNO/c1-5-17-15-16(2)7-12-20(17)21(24,13-6-14-23(3)4)18-8-10-19(22)11-9-18/h7-12,15,24H,5-6,13-14H2,1-4H3 |
| InChIKey | FWPDNYREVOXKNX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |