C20H23FNO2Sn — CID 174593138
CID 174593138 (PubChem CID 174593138) has the molecular formula C20H23FNO2Sn and a molecular weight of 447.12 g/mol.
| Compound Name | CID 174593138 |
|---|---|
| PubChem CID | 174593138 |
| Molecular Formula | C20H23FNO2Sn |
| Molecular Weight | 447.12 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | — |
| SMILES | C[Sn](C)CCC[C@](O)(c1ccc(F)cc1)c1ccc(C#N)cc1CO |
| InChI | InChI=1S/C18H17FNO2.2CH3.Sn/c1-2-9-18(22,15-4-6-16(19)7-5-15)17-8-3-13(11-20)10-14(17)12-21;;;/h3-8,10,21-22H,1-2,9,12H2;2*1H3;/t18-;;;/m0.../s1 |
| InChIKey | IFZMFRGKBLTXIL-LPECGTQYSA-N |
| XLogP | 3.96 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.12 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |