C14H18N2O2 — CID 169438752
4-[4-[bis(trideuteriomethyl)amino]butanoyl]-3-(hydroxymethyl)benzonitrile (PubChem CID 169438752) has the molecular formula C14H18N2O2 and a molecular weight of 252.35 g/mol. Its IUPAC name is 4-[4-[bis(trideuteriomethyl)amino]butanoyl]-3-(hydroxymethyl)benzonitrile.
| Compound Name | 4-[4-[bis(trideuteriomethyl)amino]butanoyl]-3-(hydroxymethyl)benzonitrile |
|---|---|
| PubChem CID | 169438752 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 4-[4-[bis(trideuteriomethyl)amino]butanoyl]-3-(hydroxymethyl)benzonitrile |
| SMILES | [2H]C([2H])([2H])N(CCCC(=O)c1ccc(C#N)cc1CO)C([2H])([2H])[2H] |
| InChI | InChI=1S/C14H18N2O2/c1-16(2)7-3-4-14(18)13-6-5-11(9-15)8-12(13)10-17/h5-6,8,17H,3-4,7,10H2,1-2H3/i1D3,2D3 |
| InChIKey | DJYBHBNFBVKAQJ-WFGJKAKNSA-N |
| XLogP | 1.58 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |