C11H20N2 — CID 143925685
5,6-diethyl-1-propan-2-yl-2H-pyrimidine (PubChem CID 143925685) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 5,6-diethyl-1-propan-2-yl-2H-pyrimidine.
| Compound Name | 5,6-diethyl-1-propan-2-yl-2H-pyrimidine |
|---|---|
| PubChem CID | 143925685 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 5,6-diethyl-1-propan-2-yl-2H-pyrimidine |
| SMILES | CCC1=C(CC)N(C(C)C)CN=C1 |
| InChI | InChI=1S/C11H20N2/c1-5-10-7-12-8-13(9(3)4)11(10)6-2/h7,9H,5-6,8H2,1-4H3 |
| InChIKey | IDNJMZAUBNFCBK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |