C10H19N2+ — CID 162287893
1,2,3,4,5,6-hexamethyl-2H-pyrimidin-3-ium (PubChem CID 162287893) has the molecular formula C10H19N2+ and a molecular weight of 167.28 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexamethyl-2H-pyrimidin-3-ium.
| Compound Name | 1,2,3,4,5,6-hexamethyl-2H-pyrimidin-3-ium |
|---|---|
| PubChem CID | 162287893 |
| Molecular Formula | C10H19N2+ |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.15 |
| IUPAC Name | 1,2,3,4,5,6-hexamethyl-2H-pyrimidin-3-ium |
| SMILES | CC1=C(C)N(C)C(C)[N+](C)=C1C |
| InChI | InChI=1S/C10H19N2/c1-7-8(2)11(5)10(4)12(6)9(7)3/h10H,1-6H3/q+1 |
| InChIKey | OHFWIHWIBXQRBH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|