C11H22N2 — CID 178170754
(E)-N,N-diethyl-3-methyl-4-methyliminopent-2-en-2-amine (PubChem CID 178170754) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (E)-N,N-diethyl-3-methyl-4-methyliminopent-2-en-2-amine.
| Compound Name | (E)-N,N-diethyl-3-methyl-4-methyliminopent-2-en-2-amine |
|---|---|
| PubChem CID | 178170754 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (E)-N,N-diethyl-3-methyl-4-methyliminopent-2-en-2-amine |
| SMILES | CCN(CC)/C(C)=C(C)/C(C)=N/C |
| InChI | InChI=1S/C11H22N2/c1-7-13(8-2)11(5)9(3)10(4)12-6/h7-8H2,1-6H3/b11-9+,12-10+ |
| InChIKey | RRDGSQKGMFZVFU-WGDLNXRISA-N |
| XLogP | 2.71 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|