C18H18N6O — CID 143926762
4-amino-2-ethoxy-6-[4-(1-methylimidazol-2-yl)anilino]pyridine-3-carbonitrile (PubChem CID 143926762) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is 4-amino-2-ethoxy-6-[4-(1-methylimidazol-2-yl)anilino]pyridine-3-carbonitrile.
| Compound Name | 4-amino-2-ethoxy-6-[4-(1-methylimidazol-2-yl)anilino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 143926762 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 4-amino-2-ethoxy-6-[4-(1-methylimidazol-2-yl)anilino]pyridine-3-carbonitrile |
| SMILES | CCOc1nc(Nc2ccc(-c3nccn3C)cc2)cc(N)c1C#N |
| InChI | InChI=1S/C18H18N6O/c1-3-25-18-14(11-19)15(20)10-16(23-18)22-13-6-4-12(5-7-13)17-21-8-9-24(17)2/h4-10H,3H2,1-2H3,(H3,20,22,23) |
| InChIKey | RJDGFVLPFLRLLL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |