C14H30N2 — CID 143929695
N'-[(Z)-but-1-enyl]-N,N-dipropylethanimidamide;ethane (PubChem CID 143929695) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is N'-[(Z)-but-1-enyl]-N,N-dipropylethanimidamide;ethane.
| Compound Name | N'-[(Z)-but-1-enyl]-N,N-dipropylethanimidamide;ethane |
|---|---|
| PubChem CID | 143929695 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N'-[(Z)-but-1-enyl]-N,N-dipropylethanimidamide;ethane |
| SMILES | CC.CC/C=C\N=C(/C)N(CCC)CCC |
| InChI | InChI=1S/C12H24N2.C2H6/c1-5-8-9-13-12(4)14(10-6-2)11-7-3;1-2/h8-9H,5-7,10-11H2,1-4H3;1-2H3/b9-8-,13-12+; |
| InChIKey | JTBXYFPILHMWQY-BZYURBCNSA-N |
| XLogP | 4.48 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|