C11H21N — CID 145278225
ethane;N-[(1Z,3E)-hexa-1,3-dienyl]propan-2-imine (PubChem CID 145278225) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is ethane;N-[(1Z,3E)-hexa-1,3-dienyl]propan-2-imine.
| Compound Name | ethane;N-[(1Z,3E)-hexa-1,3-dienyl]propan-2-imine |
|---|---|
| PubChem CID | 145278225 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | ethane;N-[(1Z,3E)-hexa-1,3-dienyl]propan-2-imine |
| SMILES | CC.CC/C=C/C=C\N=C(C)C |
| InChI | InChI=1S/C9H15N.C2H6/c1-4-5-6-7-8-10-9(2)3;1-2/h5-8H,4H2,1-3H3;1-2H3/b6-5+,8-7-; |
| InChIKey | LZSKPXAUKGGMFL-YLZQMSMDSA-N |
| XLogP | 3.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|