C12H21N — CID 134526770
N-[(1E,3Z)-6-methylocta-1,3-dienyl]propan-2-imine (PubChem CID 134526770) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is N-[(1E,3Z)-6-methylocta-1,3-dienyl]propan-2-imine.
| Compound Name | N-[(1E,3Z)-6-methylocta-1,3-dienyl]propan-2-imine |
|---|---|
| PubChem CID | 134526770 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N-[(1E,3Z)-6-methylocta-1,3-dienyl]propan-2-imine |
| SMILES | CCC(C)C/C=C\C=C\N=C(C)C |
| InChI | InChI=1S/C12H21N/c1-5-12(4)9-7-6-8-10-13-11(2)3/h6-8,10,12H,5,9H2,1-4H3/b7-6-,10-8+ |
| InChIKey | XTSLXJXYNHHUKW-VAAURPRASA-N |
| XLogP | 3.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|