C13H24 — CID 145119148
(3E,5E)-8,10-dimethylundeca-3,5-diene (PubChem CID 145119148) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is (3E,5E)-8,10-dimethylundeca-3,5-diene.
| Compound Name | (3E,5E)-8,10-dimethylundeca-3,5-diene |
|---|---|
| PubChem CID | 145119148 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | (3E,5E)-8,10-dimethylundeca-3,5-diene |
| SMILES | CC/C=C/C=C/CC(C)CC(C)C |
| InChI | InChI=1S/C13H24/c1-5-6-7-8-9-10-13(4)11-12(2)3/h6-9,12-13H,5,10-11H2,1-4H3/b7-6+,9-8+ |
| InChIKey | GIJBZADTMNJMER-BLHCBFLLSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|