C32H44N4O13 — CID 14393134
benzyl (4R)-4-[[(2S)-2-[[(2R)-2-[(1R,2S,3S,5S,6R)-2-acetamido-3,5,6-triacetyloxycyclohexyl]oxypropanoyl]amino]propanoyl]amino]-5-amino-5-oxopentanoate (PubChem CID 14393134) has the molecular formula C32H44N4O13 and a molecular weight of 692.72 g/mol. Its IUPAC name is benzyl (4R)-4-[[(2S)-2-[[(2R)-2-[(1R,2S,3S,5S,6R)-2-acetamido-3,5,6-triacetyloxycyclohexyl]oxypropanoyl]amino]propanoyl]amino]-5-amino-5-oxopentanoate.
| Compound Name | benzyl (4R)-4-[[(2S)-2-[[(2R)-2-[(1R,2S,3S,5S,6R)-2-acetamido-3,5,6-triacetyloxycyclohexyl]oxypropanoyl]amino]propanoyl]amino]-5-amino-5-oxopentanoate |
|---|---|
| PubChem CID | 14393134 |
| Molecular Formula | C32H44N4O13 |
| Molecular Weight | 692.72 g/mol |
| Exact Mass | 692.29 |
| IUPAC Name | benzyl (4R)-4-[[(2S)-2-[[(2R)-2-[(1R,2S,3S,5S,6R)-2-acetamido-3,5,6-triacetyloxycyclohexyl]oxypropanoyl]amino]propanoyl]amino]-5-amino-5-oxopentanoate |
| SMILES | CC(=O)N[C@@H]1[C@@H](O[C@H](C)C(=O)N[C@@H](C)C(=O)N[C@H](CCC(=O)OCc2ccccc2)C(N)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H44N4O13/c1-16(31(43)36-23(30(33)42)12-13-26(41)45-15-22-10-8-7-9-11-22)34-32(44)17(2)46-29-27(35-18(3)37)24(47-19(4)38)14-25(48-20(5)39)28(29)49-21(6)40/h7-11,16-17,23-25,27-29H,12-15H2,1-6H3,(H2,33,42)(H,34,44)(H,35,37)(H,36,43)/t16-,17+,23+,24-,25-,27-,28+,29+/m0/s1 |
| InChIKey | ATBSLXNQTKSIIO-LVELDPIFSA-N |
| XLogP | -0.54 |
| TPSA | 244.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.72 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|