C29H26BrFN4O6 — CID 143931804
2-[2-[8-bromo-7-[(2Z,4E)-2-ethenyl-5-fluoropenta-2,4-dienyl]-4-hydroxy-3-[(3S)-3-(2-hydroxyethylamino)oxiran-2-yl]-2-oxo-1,5-naphthyridin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 143931804) has the molecular formula C29H26BrFN4O6 and a molecular weight of 625.45 g/mol. Its IUPAC name is 2-[2-[8-bromo-7-[(2Z,4E)-2-ethenyl-5-fluoropenta-2,4-dienyl]-4-hydroxy-3-[(3S)-3-(2-hydroxyethylamino)oxiran-2-yl]-2-oxo-1,5-naphthyridin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[8-bromo-7-[(2Z,4E)-2-ethenyl-5-fluoropenta-2,4-dienyl]-4-hydroxy-3-[(3S)-3-(2-hydroxyethylamino)oxiran-2-yl]-2-oxo-1,5-naphthyridin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 143931804 |
| Molecular Formula | C29H26BrFN4O6 |
| Molecular Weight | 625.45 g/mol |
| Exact Mass | 624.10 |
| IUPAC Name | 2-[2-[8-bromo-7-[(2Z,4E)-2-ethenyl-5-fluoropenta-2,4-dienyl]-4-hydroxy-3-[(3S)-3-(2-hydroxyethylamino)oxiran-2-yl]-2-oxo-1,5-naphthyridin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | C=C/C(=C\C=C\F)Cc1cnc2c(O)c(C3O[C@@H]3NCCO)c(=O)n(CCN3C(=O)c4ccccc4C3=O)c2c1Br |
| InChI | InChI=1S/C29H26BrFN4O6/c1-2-16(6-5-9-31)14-17-15-33-22-23(21(17)30)34(29(40)20(24(22)37)25-26(41-25)32-10-13-36)11-12-35-27(38)18-7-3-4-8-19(18)28(35)39/h2-9,15,25-26,32,36-37H,1,10-14H2/b9-5+,16-6+/t25?,26-/m0/s1 |
| InChIKey | HQEZKZCZQBBIGC-AFMLRERKSA-N |
| XLogP | 3.28 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|