C10H19N3O2 — CID 143932229
1-(8-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)-3-methylurea (PubChem CID 143932229) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-(8-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)-3-methylurea.
| Compound Name | 1-(8-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)-3-methylurea |
|---|---|
| PubChem CID | 143932229 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 1-(8-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)-3-methylurea |
| SMILES | CNC(=O)NC1CC(O)C2CCCN2C1 |
| InChI | InChI=1S/C10H19N3O2/c1-11-10(15)12-7-5-9(14)8-3-2-4-13(8)6-7/h7-9,14H,2-6H2,1H3,(H2,11,12,15) |
| InChIKey | QKEGQZFCEAXMGR-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |