C9H17N3O2 — CID 143932241
(8-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)urea (PubChem CID 143932241) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is (8-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)urea.
| Compound Name | (8-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)urea |
|---|---|
| PubChem CID | 143932241 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | (8-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)urea |
| SMILES | NC(=O)NC1CC(O)C2CCCN2C1 |
| InChI | InChI=1S/C9H17N3O2/c10-9(14)11-6-4-8(13)7-2-1-3-12(7)5-6/h6-8,13H,1-5H2,(H3,10,11,14) |
| InChIKey | RNUFRODQQFXNOV-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |