C17H21N3S2 — CID 143932948
4-methyl-6-(4-methylsulfanylphenyl)-5-prop-1-ynylpyrimidin-2-amine;methylsulfanylmethane (PubChem CID 143932948) has the molecular formula C17H21N3S2 and a molecular weight of 331.51 g/mol. Its IUPAC name is 4-methyl-6-(4-methylsulfanylphenyl)-5-prop-1-ynylpyrimidin-2-amine;methylsulfanylmethane.
| Compound Name | 4-methyl-6-(4-methylsulfanylphenyl)-5-prop-1-ynylpyrimidin-2-amine;methylsulfanylmethane |
|---|---|
| PubChem CID | 143932948 |
| Molecular Formula | C17H21N3S2 |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 4-methyl-6-(4-methylsulfanylphenyl)-5-prop-1-ynylpyrimidin-2-amine;methylsulfanylmethane |
| SMILES | CC#Cc1c(C)nc(N)nc1-c1ccc(SC)cc1.CSC |
| InChI | InChI=1S/C15H15N3S.C2H6S/c1-4-5-13-10(2)17-15(16)18-14(13)11-6-8-12(19-3)9-7-11;1-3-2/h6-9H,1-3H3,(H2,16,17,18);1-2H3 |
| InChIKey | QPTLGIDUNHPFGE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|