C21H21N5O2S — CID 58513551
5-[2-[6-(ethylamino)-3-pyridinyl]ethynyl]-4-methyl-6-(4-methylsulfonylphenyl)pyrimidin-2-amine (PubChem CID 58513551) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is 5-[2-[6-(ethylamino)-3-pyridinyl]ethynyl]-4-methyl-6-(4-methylsulfonylphenyl)pyrimidin-2-amine.
| Compound Name | 5-[2-[6-(ethylamino)-3-pyridinyl]ethynyl]-4-methyl-6-(4-methylsulfonylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 58513551 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 5-[2-[6-(ethylamino)-3-pyridinyl]ethynyl]-4-methyl-6-(4-methylsulfonylphenyl)pyrimidin-2-amine |
| SMILES | CCNc1ccc(C#Cc2c(C)nc(N)nc2-c2ccc(S(C)(=O)=O)cc2)cn1 |
| InChI | InChI=1S/C21H21N5O2S/c1-4-23-19-12-6-15(13-24-19)5-11-18-14(2)25-21(22)26-20(18)16-7-9-17(10-8-16)29(3,27)28/h6-10,12-13H,4H2,1-3H3,(H,23,24)(H2,22,25,26) |
| InChIKey | YELBFJYJKIUKJQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|