C19H15N5O2 — CID 58513218
5-[2-(6-amino-3-pyridinyl)ethynyl]-4-(1,3-benzodioxol-5-yl)-6-methylpyrimidin-2-amine (PubChem CID 58513218) has the molecular formula C19H15N5O2 and a molecular weight of 345.36 g/mol. Its IUPAC name is 5-[2-(6-amino-3-pyridinyl)ethynyl]-4-(1,3-benzodioxol-5-yl)-6-methylpyrimidin-2-amine.
| Compound Name | 5-[2-(6-amino-3-pyridinyl)ethynyl]-4-(1,3-benzodioxol-5-yl)-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 58513218 |
| Molecular Formula | C19H15N5O2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 5-[2-(6-amino-3-pyridinyl)ethynyl]-4-(1,3-benzodioxol-5-yl)-6-methylpyrimidin-2-amine |
| SMILES | Cc1nc(N)nc(-c2ccc3c(c2)OCO3)c1C#Cc1ccc(N)nc1 |
| InChI | InChI=1S/C19H15N5O2/c1-11-14(5-2-12-3-7-17(20)22-9-12)18(24-19(21)23-11)13-4-6-15-16(8-13)26-10-25-15/h3-4,6-9H,10H2,1H3,(H2,20,22)(H2,21,23,24) |
| InChIKey | FLLLSFREVCOXHC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|