C21H25N5O — CID 58513326
5-[2-(6-amino-3-pyridinyl)ethynyl]-4-methyl-6-(2,2,6,6-tetramethyl-3H-pyran-4-yl)pyrimidin-2-amine (PubChem CID 58513326) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 5-[2-(6-amino-3-pyridinyl)ethynyl]-4-methyl-6-(2,2,6,6-tetramethyl-3H-pyran-4-yl)pyrimidin-2-amine.
| Compound Name | 5-[2-(6-amino-3-pyridinyl)ethynyl]-4-methyl-6-(2,2,6,6-tetramethyl-3H-pyran-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 58513326 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 5-[2-(6-amino-3-pyridinyl)ethynyl]-4-methyl-6-(2,2,6,6-tetramethyl-3H-pyran-4-yl)pyrimidin-2-amine |
| SMILES | Cc1nc(N)nc(C2=CC(C)(C)OC(C)(C)C2)c1C#Cc1ccc(N)nc1 |
| InChI | InChI=1S/C21H25N5O/c1-13-16(8-6-14-7-9-17(22)24-12-14)18(26-19(23)25-13)15-10-20(2,3)27-21(4,5)11-15/h7,9-10,12H,11H2,1-5H3,(H2,22,24)(H2,23,25,26) |
| InChIKey | REQXWBHJEGCRBE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|