C19H13ClF3N5 — CID 58513325
5-[2-(6-amino-3-pyridinyl)ethynyl]-4-[2-chloro-3-(trifluoromethyl)phenyl]-6-methylpyrimidin-2-amine (PubChem CID 58513325) has the molecular formula C19H13ClF3N5 and a molecular weight of 403.80 g/mol. Its IUPAC name is 5-[2-(6-amino-3-pyridinyl)ethynyl]-4-[2-chloro-3-(trifluoromethyl)phenyl]-6-methylpyrimidin-2-amine.
| Compound Name | 5-[2-(6-amino-3-pyridinyl)ethynyl]-4-[2-chloro-3-(trifluoromethyl)phenyl]-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 58513325 |
| Molecular Formula | C19H13ClF3N5 |
| Molecular Weight | 403.80 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 5-[2-(6-amino-3-pyridinyl)ethynyl]-4-[2-chloro-3-(trifluoromethyl)phenyl]-6-methylpyrimidin-2-amine |
| SMILES | Cc1nc(N)nc(-c2cccc(C(F)(F)F)c2Cl)c1C#Cc1ccc(N)nc1 |
| InChI | InChI=1S/C19H13ClF3N5/c1-10-12(7-5-11-6-8-15(24)26-9-11)17(28-18(25)27-10)13-3-2-4-14(16(13)20)19(21,22)23/h2-4,6,8-9H,1H3,(H2,24,26)(H2,25,27,28) |
| InChIKey | VBEHPGNJSZEGDI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.80 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|