C20H15FN6 — CID 58513505
3-[2-amino-6-methyl-5-[2-[6-(methylamino)-3-pyridinyl]ethynyl]pyrimidin-4-yl]-4-fluorobenzonitrile (PubChem CID 58513505) has the molecular formula C20H15FN6 and a molecular weight of 358.38 g/mol. Its IUPAC name is 3-[2-amino-6-methyl-5-[2-[6-(methylamino)-3-pyridinyl]ethynyl]pyrimidin-4-yl]-4-fluorobenzonitrile.
| Compound Name | 3-[2-amino-6-methyl-5-[2-[6-(methylamino)-3-pyridinyl]ethynyl]pyrimidin-4-yl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 58513505 |
| Molecular Formula | C20H15FN6 |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 3-[2-amino-6-methyl-5-[2-[6-(methylamino)-3-pyridinyl]ethynyl]pyrimidin-4-yl]-4-fluorobenzonitrile |
| SMILES | CNc1ccc(C#Cc2c(C)nc(N)nc2-c2cc(C#N)ccc2F)cn1 |
| InChI | InChI=1S/C20H15FN6/c1-12-15(6-3-13-5-8-18(24-2)25-11-13)19(27-20(23)26-12)16-9-14(10-22)4-7-17(16)21/h4-5,7-9,11H,1-2H3,(H,24,25)(H2,23,26,27) |
| InChIKey | SRFQIMGFEWFASB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|