C20H17F3N6 — CID 58513514
5-[2-[6-(ethylamino)-3-pyridinyl]ethynyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine (PubChem CID 58513514) has the molecular formula C20H17F3N6 and a molecular weight of 398.39 g/mol. Its IUPAC name is 5-[2-[6-(ethylamino)-3-pyridinyl]ethynyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[2-[6-(ethylamino)-3-pyridinyl]ethynyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 58513514 |
| Molecular Formula | C20H17F3N6 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 5-[2-[6-(ethylamino)-3-pyridinyl]ethynyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CCNc1ccc(C#Cc2c(N)nc(N)nc2-c2cccc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C20H17F3N6/c1-2-26-16-9-7-12(11-27-16)6-8-15-17(28-19(25)29-18(15)24)13-4-3-5-14(10-13)20(21,22)23/h3-5,7,9-11H,2H2,1H3,(H,26,27)(H4,24,25,28,29) |
| InChIKey | FFRJXVGQTXMWQA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|