C20H25FINS2 — CID 143934296
[2-(3-fluorophenyl)-5-propylpyrrolidin-1-yl] thiohypoiodite;4-methylbenzenethiol (PubChem CID 143934296) has the molecular formula C20H25FINS2 and a molecular weight of 489.46 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-5-propylpyrrolidin-1-yl] thiohypoiodite;4-methylbenzenethiol.
| Compound Name | [2-(3-fluorophenyl)-5-propylpyrrolidin-1-yl] thiohypoiodite;4-methylbenzenethiol |
|---|---|
| PubChem CID | 143934296 |
| Molecular Formula | C20H25FINS2 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | [2-(3-fluorophenyl)-5-propylpyrrolidin-1-yl] thiohypoiodite;4-methylbenzenethiol |
| SMILES | CCCC1CCC(c2cccc(F)c2)N1SI.Cc1ccc(S)cc1 |
| InChI | InChI=1S/C13H17FINS.C7H8S/c1-2-4-12-7-8-13(16(12)17-15)10-5-3-6-11(14)9-10;1-6-2-4-7(8)5-3-6/h3,5-6,9,12-13H,2,4,7-8H2,1H3;2-5,8H,1H3 |
| InChIKey | QTNUARDLVXHQPQ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|