C32H53NO5 — CID 143935396
ethane;[(1R,5R,6R,11S,12R)-1,2,5,11,15,15-hexamethyl-6-[(E)-1-(methylamino)but-1-en-2-yl]-8,16-dioxo-7-oxatricyclo[12.4.0.05,10]octadec-9-en-12-yl] acetate (PubChem CID 143935396) has the molecular formula C32H53NO5 and a molecular weight of 531.78 g/mol. Its IUPAC name is ethane;[(1R,5R,6R,11S,12R)-1,2,5,11,15,15-hexamethyl-6-[(E)-1-(methylamino)but-1-en-2-yl]-8,16-dioxo-7-oxatricyclo[12.4.0.05,10]octadec-9-en-12-yl] acetate.
| Compound Name | ethane;[(1R,5R,6R,11S,12R)-1,2,5,11,15,15-hexamethyl-6-[(E)-1-(methylamino)but-1-en-2-yl]-8,16-dioxo-7-oxatricyclo[12.4.0.05,10]octadec-9-en-12-yl] acetate |
|---|---|
| PubChem CID | 143935396 |
| Molecular Formula | C32H53NO5 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.39 |
| IUPAC Name | ethane;[(1R,5R,6R,11S,12R)-1,2,5,11,15,15-hexamethyl-6-[(E)-1-(methylamino)but-1-en-2-yl]-8,16-dioxo-7-oxatricyclo[12.4.0.05,10]octadec-9-en-12-yl] acetate |
| SMILES | CC.CC/C(=C\NC)[C@@H]1OC(=O)C=C2[C@H](C)[C@H](OC(C)=O)CC3C(C)(C)C(=O)CC[C@]3(C)C(C)CC[C@]21C |
| InChI | InChI=1S/C30H47NO5.C2H6/c1-10-21(17-31-9)27-30(8)13-11-18(2)29(7)14-12-25(33)28(5,6)24(29)16-23(35-20(4)32)19(3)22(30)15-26(34)36-27;1-2/h15,17-19,23-24,27,31H,10-14,16H2,1-9H3;1-2H3/b21-17+;/t18?,19-,23+,24?,27-,29+,30+;/m0./s1 |
| InChIKey | HJFJPUUWTRODFA-ATZUTUMCSA-N |
| XLogP | 6.78 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |