C27H37NO6 — CID 91209945
[1-(4,5-dihydro-1,3-oxazol-4-yl)-4b,7,7,10a,12a-pentamethyl-3,8-dioxo-5,6,6a,9,10,10b,11,12-octahydro-1H-naphtho[2,1-f]isochromen-5-yl] acetate (PubChem CID 91209945) has the molecular formula C27H37NO6 and a molecular weight of 471.59 g/mol. Its IUPAC name is [1-(4,5-dihydro-1,3-oxazol-4-yl)-4b,7,7,10a,12a-pentamethyl-3,8-dioxo-5,6,6a,9,10,10b,11,12-octahydro-1H-naphtho[2,1-f]isochromen-5-yl] acetate.
| Compound Name | [1-(4,5-dihydro-1,3-oxazol-4-yl)-4b,7,7,10a,12a-pentamethyl-3,8-dioxo-5,6,6a,9,10,10b,11,12-octahydro-1H-naphtho[2,1-f]isochromen-5-yl] acetate |
|---|---|
| PubChem CID | 91209945 |
| Molecular Formula | C27H37NO6 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | [1-(4,5-dihydro-1,3-oxazol-4-yl)-4b,7,7,10a,12a-pentamethyl-3,8-dioxo-5,6,6a,9,10,10b,11,12-octahydro-1H-naphtho[2,1-f]isochromen-5-yl] acetate |
| SMILES | CC(=O)OC1CC2C(C)(C)C(=O)CCC2(C)C2CCC3(C)C(=CC(=O)OC3C3COC=N3)C12C |
| InChI | InChI=1S/C27H37NO6/c1-15(29)33-21-11-18-24(2,3)20(30)8-10-25(18,4)17-7-9-26(5)19(27(17,21)6)12-22(31)34-23(26)16-13-32-14-28-16/h12,14,16-18,21,23H,7-11,13H2,1-6H3 |
| InChIKey | AEOFFIUBMYCFRV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |