C21H25N3O3 — CID 143936480
ethane;7-(3-methoxy-4-morpholin-4-ylphenyl)-6H-1,6-naphthyridin-5-one (PubChem CID 143936480) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is ethane;7-(3-methoxy-4-morpholin-4-ylphenyl)-6H-1,6-naphthyridin-5-one.
| Compound Name | ethane;7-(3-methoxy-4-morpholin-4-ylphenyl)-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 143936480 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | ethane;7-(3-methoxy-4-morpholin-4-ylphenyl)-6H-1,6-naphthyridin-5-one |
| SMILES | CC.COc1cc(-c2cc3ncccc3c(=O)[nH]2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H19N3O3.C2H6/c1-24-18-11-13(4-5-17(18)22-7-9-25-10-8-22)15-12-16-14(19(23)21-15)3-2-6-20-16;1-2/h2-6,11-12H,7-10H2,1H3,(H,21,23);1-2H3 |
| InChIKey | XNLPXOPKHWTSFD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |