C36H38N4O5S — CID 143937466
(Z)-3-[3-hydroxy-6-[1-hydroxy-2-[2-[5-[[[2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]methylamino]methyl]thiophen-2-yl]ethylamino]ethyl]-2-(methylamino)phenyl]prop-2-enal (PubChem CID 143937466) has the molecular formula C36H38N4O5S and a molecular weight of 638.79 g/mol. Its IUPAC name is (Z)-3-[3-hydroxy-6-[1-hydroxy-2-[2-[5-[[[2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]methylamino]methyl]thiophen-2-yl]ethylamino]ethyl]-2-(methylamino)phenyl]prop-2-enal.
| Compound Name | (Z)-3-[3-hydroxy-6-[1-hydroxy-2-[2-[5-[[[2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]methylamino]methyl]thiophen-2-yl]ethylamino]ethyl]-2-(methylamino)phenyl]prop-2-enal |
|---|---|
| PubChem CID | 143937466 |
| Molecular Formula | C36H38N4O5S |
| Molecular Weight | 638.79 g/mol |
| Exact Mass | 638.26 |
| IUPAC Name | (Z)-3-[3-hydroxy-6-[1-hydroxy-2-[2-[5-[[[2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]methylamino]methyl]thiophen-2-yl]ethylamino]ethyl]-2-(methylamino)phenyl]prop-2-enal |
| SMILES | CNc1c(O)ccc(C(O)CNCCc2ccc(CNCc3cnc(C(O)(c4ccccc4)c4ccccc4)o3)s2)c1/C=C\C=O |
| InChI | InChI=1S/C36H38N4O5S/c1-37-34-31(13-8-20-41)30(16-17-32(34)42)33(43)24-38-19-18-28-14-15-29(46-28)23-39-21-27-22-40-35(45-27)36(44,25-9-4-2-5-10-25)26-11-6-3-7-12-26/h2-17,20,22,33,37-39,42-44H,18-19,21,23-24H2,1H3/b13-8- |
| InChIKey | YRSDVKBBTXRRMO-JYRVWZFOSA-N |
| XLogP | 5.14 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.79 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|