C42H49N3O4 — CID 143017420
ethane;(Z)-3-[6-[2-[2-[4-[3-[(3E)-hexa-1,3,5-trien-3-yl]-4-methoxyanilino]phenyl]ethylamino]-1-hydroxyethyl]-2-(methylamino)-3-phenylmethoxyphenyl]prop-2-enal (PubChem CID 143017420) has the molecular formula C42H49N3O4 and a molecular weight of 659.87 g/mol. Its IUPAC name is ethane;(Z)-3-[6-[2-[2-[4-[3-[(3E)-hexa-1,3,5-trien-3-yl]-4-methoxyanilino]phenyl]ethylamino]-1-hydroxyethyl]-2-(methylamino)-3-phenylmethoxyphenyl]prop-2-enal.
| Compound Name | ethane;(Z)-3-[6-[2-[2-[4-[3-[(3E)-hexa-1,3,5-trien-3-yl]-4-methoxyanilino]phenyl]ethylamino]-1-hydroxyethyl]-2-(methylamino)-3-phenylmethoxyphenyl]prop-2-enal |
|---|---|
| PubChem CID | 143017420 |
| Molecular Formula | C42H49N3O4 |
| Molecular Weight | 659.87 g/mol |
| Exact Mass | 659.37 |
| IUPAC Name | ethane;(Z)-3-[6-[2-[2-[4-[3-[(3E)-hexa-1,3,5-trien-3-yl]-4-methoxyanilino]phenyl]ethylamino]-1-hydroxyethyl]-2-(methylamino)-3-phenylmethoxyphenyl]prop-2-enal |
| SMILES | C=C/C=C(\C=C)c1cc(Nc2ccc(CCNCC(O)c3ccc(OCc4ccccc4)c(NC)c3/C=C\C=O)cc2)ccc1OC.CC |
| InChI | InChI=1S/C40H43N3O4.C2H6/c1-5-11-31(6-2)36-26-33(19-21-38(36)46-4)43-32-17-15-29(16-18-32)23-24-42-27-37(45)34-20-22-39(40(41-3)35(34)14-10-25-44)47-28-30-12-8-7-9-13-30;1-2/h5-22,25-26,37,41-43,45H,1-2,23-24,27-28H2,3-4H3;1-2H3/b14-10-,31-11+; |
| InChIKey | QISXCIGYNADMKG-WEHFWNALSA-N |
| XLogP | 8.92 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.87 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|