C39H49N4O5+ — CID 24811779
[2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]methyl-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonyl]-dimethylazanium (PubChem CID 24811779) has the molecular formula C39H49N4O5+ and a molecular weight of 653.84 g/mol. Its IUPAC name is [2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]methyl-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonyl]-dimethylazanium.
| Compound Name | [2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]methyl-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonyl]-dimethylazanium |
|---|---|
| PubChem CID | 24811779 |
| Molecular Formula | C39H49N4O5+ |
| Molecular Weight | 653.84 g/mol |
| Exact Mass | 653.37 |
| IUPAC Name | [2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]methyl-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCCCCCCCNC[C@H](O)c1ccc(O)c2[nH]c(=O)ccc12)Cc1cnc(C(O)(c2ccccc2)c2ccccc2)o1 |
| InChI | InChI=1S/C39H48N4O5/c1-43(2,28-31-26-41-38(48-31)39(47,29-16-10-8-11-17-29)30-18-12-9-13-19-30)25-15-7-5-3-4-6-14-24-40-27-35(45)32-20-22-34(44)37-33(32)21-23-36(46)42-37/h8-13,16-23,26,35,40,45,47H,3-7,14-15,24-25,27-28H2,1-2H3,(H-,42,44,46)/p+1/t35-/m0/s1 |
| InChIKey | SBEFSHHMZPTSTD-DHUJRADRSA-O |
| XLogP | 6.14 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.84 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|