C15H26N2O3 — CID 143937772
methyl N-[2-[acetyl(methyl)amino]ethyl]-N-[(3E,5Z)-3-methylhepta-3,5-dien-2-yl]carbamate (PubChem CID 143937772) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl N-[2-[acetyl(methyl)amino]ethyl]-N-[(3E,5Z)-3-methylhepta-3,5-dien-2-yl]carbamate.
| Compound Name | methyl N-[2-[acetyl(methyl)amino]ethyl]-N-[(3E,5Z)-3-methylhepta-3,5-dien-2-yl]carbamate |
|---|---|
| PubChem CID | 143937772 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | methyl N-[2-[acetyl(methyl)amino]ethyl]-N-[(3E,5Z)-3-methylhepta-3,5-dien-2-yl]carbamate |
| SMILES | C/C=C\C=C(/C)C(C)N(CCN(C)C(C)=O)C(=O)OC |
| InChI | InChI=1S/C15H26N2O3/c1-7-8-9-12(2)13(3)17(15(19)20-6)11-10-16(5)14(4)18/h7-9,13H,10-11H2,1-6H3/b8-7-,12-9+ |
| InChIKey | LHOJLPNEFRXUOE-HVTAIUIQSA-N |
| XLogP | 2.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|