C11H8FN5 — CID 143938002
6-(6-fluoroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-amine (PubChem CID 143938002) has the molecular formula C11H8FN5 and a molecular weight of 229.22 g/mol. Its IUPAC name is 6-(6-fluoroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-amine.
| Compound Name | 6-(6-fluoroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 143938002 |
| Molecular Formula | C11H8FN5 |
| Molecular Weight | 229.22 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 6-(6-fluoroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-amine |
| SMILES | Nc1cncc(-c2cnc3ccc(F)cn23)n1 |
| InChI | InChI=1S/C11H8FN5/c12-7-1-2-11-15-4-9(17(11)6-7)8-3-14-5-10(13)16-8/h1-6H,(H2,13,16) |
| InChIKey | GQKFJICHSANMEM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |