C10H23N — CID 143938327
ethane;N-ethenyl-N,3-dimethylbutan-2-amine (PubChem CID 143938327) has the molecular formula C10H23N and a molecular weight of 157.30 g/mol. Its IUPAC name is ethane;N-ethenyl-N,3-dimethylbutan-2-amine.
| Compound Name | ethane;N-ethenyl-N,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 143938327 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | ethane;N-ethenyl-N,3-dimethylbutan-2-amine |
| SMILES | C=CN(C)C(C)C(C)C.CC |
| InChI | InChI=1S/C8H17N.C2H6/c1-6-9(5)8(4)7(2)3;1-2/h6-8H,1H2,2-5H3;1-2H3 |
| InChIKey | AZNKZMUVYLZNEA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |