C17H12FNO3 — CID 143939008
methyl 4-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]cyclohex-4-en-2-yne-1-carboxylate (PubChem CID 143939008) has the molecular formula C17H12FNO3 and a molecular weight of 297.29 g/mol. Its IUPAC name is methyl 4-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]cyclohex-4-en-2-yne-1-carboxylate.
| Compound Name | methyl 4-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]cyclohex-4-en-2-yne-1-carboxylate |
|---|---|
| PubChem CID | 143939008 |
| Molecular Formula | C17H12FNO3 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | methyl 4-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]cyclohex-4-en-2-yne-1-carboxylate |
| SMILES | COC(=O)C1C#CC(c2coc(-c3ccc(F)cc3)n2)=CC1 |
| InChI | InChI=1S/C17H12FNO3/c1-21-17(20)13-4-2-11(3-5-13)15-10-22-16(19-15)12-6-8-14(18)9-7-12/h2,6-10,13H,4H2,1H3 |
| InChIKey | VUHVKJACJRHSAQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|