C22H22N4O3 — CID 143939911
5-(5-but-2-ynyl-2,4-dimethoxyphenyl)-4-(4-methylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 143939911) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 5-(5-but-2-ynyl-2,4-dimethoxyphenyl)-4-(4-methylphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-(5-but-2-ynyl-2,4-dimethoxyphenyl)-4-(4-methylphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 143939911 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 5-(5-but-2-ynyl-2,4-dimethoxyphenyl)-4-(4-methylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | CC#CCc1cc(-c2nnc(C(N)=O)n2-c2ccc(C)cc2)c(OC)cc1OC |
| InChI | InChI=1S/C22H22N4O3/c1-5-6-7-15-12-17(19(29-4)13-18(15)28-3)21-24-25-22(20(23)27)26(21)16-10-8-14(2)9-11-16/h8-13H,7H2,1-4H3,(H2,23,27) |
| InChIKey | HCXYLSAHYPDLDL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|