C25H33F3N4O3 — CID 176552304
ethane;5-(5-ethyl-2,4-dihydroxyphenyl)-4-(4-methylphenyl)-N-(1,1,1-trifluoropropan-2-yl)-1,2,4-triazole-3-carboxamide (PubChem CID 176552304) has the molecular formula C25H33F3N4O3 and a molecular weight of 494.56 g/mol. Its IUPAC name is ethane;5-(5-ethyl-2,4-dihydroxyphenyl)-4-(4-methylphenyl)-N-(1,1,1-trifluoropropan-2-yl)-1,2,4-triazole-3-carboxamide.
| Compound Name | ethane;5-(5-ethyl-2,4-dihydroxyphenyl)-4-(4-methylphenyl)-N-(1,1,1-trifluoropropan-2-yl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 176552304 |
| Molecular Formula | C25H33F3N4O3 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | ethane;5-(5-ethyl-2,4-dihydroxyphenyl)-4-(4-methylphenyl)-N-(1,1,1-trifluoropropan-2-yl)-1,2,4-triazole-3-carboxamide |
| SMILES | CC.CC.CCc1cc(-c2nnc(C(=O)NC(C)C(F)(F)F)n2-c2ccc(C)cc2)c(O)cc1O |
| InChI | InChI=1S/C21H21F3N4O3.2C2H6/c1-4-13-9-15(17(30)10-16(13)29)18-26-27-19(20(31)25-12(3)21(22,23)24)28(18)14-7-5-11(2)6-8-14;2*1-2/h5-10,12,29-30H,4H2,1-3H3,(H,25,31);2*1-2H3 |
| InChIKey | ISKZSWUOQCWFKY-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |