C32H40F3N7O4 — CID 155200785
4-[4-[[4-[(1-acetylpiperidin-4-yl)methyl]piperazin-1-yl]methyl]phenyl]-5-(5-ethyl-2,4-dihydroxyphenyl)-N-(2,2,2-trifluoroethyl)-1,2,4-triazole-3-carboxamide (PubChem CID 155200785) has the molecular formula C32H40F3N7O4 and a molecular weight of 643.71 g/mol. Its IUPAC name is 4-[4-[[4-[(1-acetylpiperidin-4-yl)methyl]piperazin-1-yl]methyl]phenyl]-5-(5-ethyl-2,4-dihydroxyphenyl)-N-(2,2,2-trifluoroethyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 4-[4-[[4-[(1-acetylpiperidin-4-yl)methyl]piperazin-1-yl]methyl]phenyl]-5-(5-ethyl-2,4-dihydroxyphenyl)-N-(2,2,2-trifluoroethyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 155200785 |
| Molecular Formula | C32H40F3N7O4 |
| Molecular Weight | 643.71 g/mol |
| Exact Mass | 643.31 |
| IUPAC Name | 4-[4-[[4-[(1-acetylpiperidin-4-yl)methyl]piperazin-1-yl]methyl]phenyl]-5-(5-ethyl-2,4-dihydroxyphenyl)-N-(2,2,2-trifluoroethyl)-1,2,4-triazole-3-carboxamide |
| SMILES | CCc1cc(-c2nnc(C(=O)NCC(F)(F)F)n2-c2ccc(CN3CCN(CC4CCN(C(C)=O)CC4)CC3)cc2)c(O)cc1O |
| InChI | InChI=1S/C32H40F3N7O4/c1-3-24-16-26(28(45)17-27(24)44)29-37-38-30(31(46)36-20-32(33,34)35)42(29)25-6-4-22(5-7-25)18-39-12-14-40(15-13-39)19-23-8-10-41(11-9-23)21(2)43/h4-7,16-17,23,44-45H,3,8-15,18-20H2,1-2H3,(H,36,46) |
| InChIKey | HRQKCBKNVFPLRN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 127.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.71 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |