C16H22N2O — CID 143940140
[3-[1-[[(E)-2-propoxybut-2-enylidene]amino]ethenyl]phenyl]methanamine (PubChem CID 143940140) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is [3-[1-[[(E)-2-propoxybut-2-enylidene]amino]ethenyl]phenyl]methanamine.
| Compound Name | [3-[1-[[(E)-2-propoxybut-2-enylidene]amino]ethenyl]phenyl]methanamine |
|---|---|
| PubChem CID | 143940140 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | [3-[1-[[(E)-2-propoxybut-2-enylidene]amino]ethenyl]phenyl]methanamine |
| SMILES | C=C(/N=C/C(=C\C)OCCC)c1cccc(CN)c1 |
| InChI | InChI=1S/C16H22N2O/c1-4-9-19-16(5-2)12-18-13(3)15-8-6-7-14(10-15)11-17/h5-8,10,12H,3-4,9,11,17H2,1-2H3/b16-5+,18-12+ |
| InChIKey | LUVQAIWHGXAEAX-HUAUDRMCSA-N |
| XLogP | 3.52 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|