C18H27NO — CID 153350537
[3-[(3Z)-4-but-1-en-2-yloxypenta-1,3-dien-3-yl]phenyl]methanamine;ethane (PubChem CID 153350537) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is [3-[(3Z)-4-but-1-en-2-yloxypenta-1,3-dien-3-yl]phenyl]methanamine;ethane.
| Compound Name | [3-[(3Z)-4-but-1-en-2-yloxypenta-1,3-dien-3-yl]phenyl]methanamine;ethane |
|---|---|
| PubChem CID | 153350537 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | [3-[(3Z)-4-but-1-en-2-yloxypenta-1,3-dien-3-yl]phenyl]methanamine;ethane |
| SMILES | C=C/C(=C(\C)OC(=C)CC)c1cccc(CN)c1.CC |
| InChI | InChI=1S/C16H21NO.C2H6/c1-5-12(3)18-13(4)16(6-2)15-9-7-8-14(10-15)11-17;1-2/h6-10H,2-3,5,11,17H2,1,4H3;1-2H3/b16-13-; |
| InChIKey | LEQPQKKBRYGLDI-UNVLYCKESA-N |
| XLogP | 5.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|